Molecular Structure:
CCD No.:CCD02123003
SELENA SEL10507320
Formula:C14 H16 N2 S
MolWeight:244.36
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10507320 |
| English Synonyms： | SELENA SEL10507320 |
| MDL Number.： | MFCD13431915 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | CC(c1nc-2c(s1)CCCc3c2cccc3)N |
| InChi： | InChI=1S/C14H16N2S/c1-9(15)14-16-13-11-7-3-2-5-10(11)6-4-8-12(13)17-14/h2-3,5,7,9H,4,6,8,15H2,1H3 |
| InChiKey： | InChIKey=ZTFGGXRGUFMVCM-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
