Molecular Structure:
CCD No.:CCD02143256
SELENA SEL10530667
Formula:C9 H11 F N4 O2 S
MolWeight:258.276
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10530667 |
| English Synonyms： | SELENA SEL10530667 |
| MDL Number.： | MFCD13452203 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | Cc1ccc(cc1S(=O)(=O)NCCN=[N+]=[N-])F |
| InChi： | InChI=1S/C9H11FN4O2S/c1-7-2-3-8(10)6-9(7)17(15,16)13-5-4-12-14-11/h2-3,6,13H,4-5H2,1H3 |
| InChiKey： | InChIKey=HBWYWHIBYQEWFC-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
