Molecular Structure:
CCD No.:CCD02143459
SELENA SEL10530877
Formula:C9 H10 Cl2 N4 O2 S
MolWeight:309.176
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10530877 |
| English Synonyms： | SELENA SEL10530877 |
| MDL Number.： | MFCD13452406 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | c1cc(c(cc1S(=O)(=O)NCCCN=[N+]=[N-])Cl)Cl |
| InChi： | InChI=1S/C9H10Cl2N4O2S/c10-8-3-2-7(6-9(8)11)18(16,17)14-5-1-4-13-15-12/h2-3,6,14H,1,4-5H2 |
| InChiKey： | InChIKey=ZSLAZVGPWQMLCC-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
