* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-(ETHYLAMINO)-2H,3H,4H,7H,8H,9H-[1,4]DIOXEPINO[2,3-F]INDOL-8-ONE |
English Synonyms: | 9-(ETHYLAMINO)-2H,3H,4H,7H,8H,9H-[1,4]DIOXEPINO[2,3-F]INDOL-8-ONE |
MDL Number.: | MFCD13454554 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | C(C)NC1C(NC=2C=C3C(=CC12)OCCCO3)=O |
InChi: | InChI=1S/C13H16N2O3/c1-2-14-12-8-6-10-11(18-5-3-4-17-10)7-9(8)15-13(12)16/h6-7,12,14H,2-5H2,1H3,(H,15,16) |
InChiKey: | InChIKey=CAIYTUNDTXSRES-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.