* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC736174 |
| English Synonyms: | BCH-RESEARCH BC736174 |
| MDL Number.: | MFCD13458294 |
| H bond acceptor: | 8 |
| H bond donor: | 4 |
| Smile: | c1cc(c(cc1N)C(=O)O)NS(=O)(=O)CC(=O)O |
| InChi: | InChI=1S/C9H10N2O6S/c10-5-1-2-7(6(3-5)9(14)15)11-18(16,17)4-8(12)13/h1-3,11H,4,10H2,(H,12,13)(H,14,15) |
| InChiKey: | InChIKey=NXULJSOGLNZSRP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.