Molecular Structure:
CCD No.:CCD02150592
SELENA SEL10538697
Formula:C11 H17 N O5 S
MolWeight:275.323
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10538697 |
| English Synonyms： | SELENA SEL10538697 |
| MDL Number.： | MFCD13459542 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | C1CC(N(C1)C(=O)C2CCS(=O)(=O)C2)CC(=O)O |
| InChi： | InChI=1S/C11H17NO5S/c13-10(14)6-9-2-1-4-12(9)11(15)8-3-5-18(16,17)7-8/h8-9H,1-7H2,(H,13,14) |
| InChiKey： | InChIKey=ZBESPMBCOOVMRN-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
