* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC319222 |
English Synonyms: | BCH-RESEARCH BC319222 |
MDL Number.: | MFCD13461444 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCCC(C)(C(=O)OC)NS(=O)(=O)c1c(ccs1)Br |
InChi: | InChI=1S/C11H16BrNO4S2/c1-4-6-11(2,10(14)17-3)13-19(15,16)9-8(12)5-7-18-9/h5,7,13H,4,6H2,1-3H3 |
InChiKey: | InChIKey=PDBWHJBVUJGYQC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.