* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC425598 |
English Synonyms: | BCH-RESEARCH BC425598 |
MDL Number.: | MFCD13461517 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCNC(=O)CN(C)S(=O)(=O)c1c(ccs1)Br |
InChi: | InChI=1S/C9H13BrN2O3S2/c1-3-11-8(13)6-12(2)17(14,15)9-7(10)4-5-16-9/h4-5H,3,6H2,1-2H3,(H,11,13) |
InChiKey: | InChIKey=SMEZGXAGQXESHL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.