* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SELENA SEL10539703 |
| English Synonyms: | SELENA SEL10539703 |
| MDL Number.: | MFCD13469936 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CC(C)[C@@H](C(=O)OC)NC(=O)CC1CCCN1 |
| InChi: | InChI=1S/C12H22N2O3/c1-8(2)11(12(16)17-3)14-10(15)7-9-5-4-6-13-9/h8-9,11,13H,4-7H2,1-3H3,(H,14,15)/t9?,11-/m0/s1 |
| InChiKey: | InChIKey=ZRQJPHNONSDAMH-UMJHXOGRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.