Molecular Structure:
CCD No.:CCD02158475
SELENA SEL10623847
Formula:C11 H18 N2 O3 S
MolWeight:258.34
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10623847 |
| English Synonyms： | SELENA SEL10623847 |
| MDL Number.： | MFCD13474877 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | CCCN(CCO)S(=O)(=O)c1ccc(cc1)N |
| InChi： | InChI=1S/C11H18N2O3S/c1-2-7-13(8-9-14)17(15,16)11-5-3-10(12)4-6-11/h3-6,14H,2,7-9,12H2,1H3 |
| InChiKey： | InChIKey=VEHLGWQGADVATJ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
