Molecular Structure:
CCD No.:CCD02162837
SELENA SEL10571220
Formula:C13 H19 N O3 S
MolWeight:269.363
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10571220 |
| English Synonyms： | SELENA SEL10571220 |
| MDL Number.： | MFCD13479250 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | CCc1ccsc1C(=O)N(CC(=O)O)C(C)CC |
| InChi： | InChI=1S/C13H19NO3S/c1-4-9(3)14(8-11(15)16)13(17)12-10(5-2)6-7-18-12/h6-7,9H,4-5,8H2,1-3H3,(H,15,16) |
| InChiKey： | InChIKey=MONPQWZANDPCIA-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
