Molecular Structure:
CCD No.:CCD02165474
SELENA SEL10574300
Formula:C11 H12 I N O3 S
MolWeight:365.186
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10574300 |
| English Synonyms： | SELENA SEL10574300 |
| MDL Number.： | MFCD13481891 |
| H bond acceptor： | 4 |
| H bond donor： | 0 |
| Smile： | c1cc(cc(c1)I)C(=O)N2CCS(=O)(=O)CC2 |
| InChi： | InChI=1S/C11H12INO3S/c12-10-3-1-2-9(8-10)11(14)13-4-6-17(15,16)7-5-13/h1-3,8H,4-7H2 |
| InChiKey： | InChIKey=VLHSCHCXKYHRGQ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
