Molecular Structure:
CCD No.:CCD02176546
SELENA SEL10586349
Formula:C13 H21 N O3 S
MolWeight:271.379
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10586349 |
| English Synonyms： | SELENA SEL10586349 |
| MDL Number.： | MFCD13492972 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | CCCCN(CCO)S(=O)(=O)c1ccc(cc1)C |
| InChi： | InChI=1S/C13H21NO3S/c1-3-4-9-14(10-11-15)18(16,17)13-7-5-12(2)6-8-13/h5-8,15H,3-4,9-11H2,1-2H3 |
| InChiKey： | InChIKey=RISDXRXQROBDQD-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
