Molecular Structure:
CCD No.:CCD02177076
SELENA SEL10439915
Formula:C13 H18 N2 O3 S
MolWeight:282.362
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10439915 |
| English Synonyms： | SELENA SEL10439915 |
| MDL Number.： | MFCD13493504 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | CC(C)[C@@H](C(=O)O)NC(=O)N1CCc2c(ccs2)C1 |
| InChi： | InChI=1S/C13H18N2O3S/c1-8(2)11(12(16)17)14-13(18)15-5-3-10-9(7-15)4-6-19-10/h4,6,8,11H,3,5,7H2,1-2H3,(H,14,18)(H,16,17)/t11-/m0/s1 |
| InChiKey： | InChIKey=IKOPBSAZQKGWBU-NSHDSACASA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
