Molecular Structure:
CCD No.:CCD02177083
SELENA SEL10440183
Formula:C11 H19 N3 O4
MolWeight:257.288
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10440183 |
| English Synonyms： | SELENA SEL10440183 |
| MDL Number.： | MFCD13493511 |
| H bond acceptor： | 7 |
| H bond donor： | 3 |
| Smile： | C1CCN(CC1)C(=O)N[C@@H](CCC(=O)N)C(=O)O |
| InChi： | InChI=1S/C11H19N3O4/c12-9(15)5-4-8(10(16)17)13-11(18)14-6-2-1-3-7-14/h8H,1-7H2,(H2,12,15)(H,13,18)(H,16,17)/t8-/m0/s1 |
| InChiKey： | InChIKey=CDLDEZDTZPGGLL-QMMMGPOBSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
