Molecular Structure:
CCD No.:CCD02177448
SELENA SEL10447446
Formula:C9 H14 N2 O5 S2
MolWeight:294.351
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10447446 |
| English Synonyms： | SELENA SEL10447446 |
| MDL Number.： | MFCD13493876 |
| H bond acceptor： | 7 |
| H bond donor： | 1 |
| Smile： | C1CS(=O)(=O)CCN1C(=O)N2CSC[C@H]2C(=O)O |
| InChi： | InChI=1S/C9H14N2O5S2/c12-8(13)7-5-17-6-11(7)9(14)10-1-3-18(15,16)4-2-10/h7H,1-6H2,(H,12,13)/t7-/m0/s1 |
| InChiKey： | InChIKey=UWFWTCDFPDIREW-ZETCQYMHSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
