Molecular Structure:
CCD No.:CCD02177980
SELENA SEL10432987
Formula:C12 H18 N2 O4
MolWeight:254.284
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10432987 |
| English Synonyms： | SELENA SEL10432987 |
| MDL Number.： | MFCD13494408 |
| H bond acceptor： | 6 |
| H bond donor： | 2 |
| Smile： | CCC(C)[C@@H](C(=O)O)NC(=O)c1c(noc1C)C |
| InChi： | InChI=1S/C12H18N2O4/c1-5-6(2)10(12(16)17)13-11(15)9-7(3)14-18-8(9)4/h6,10H,5H2,1-4H3,(H,13,15)(H,16,17)/t6?,10-/m0/s1 |
| InChiKey： | InChIKey=IBGPMSRHJCHHFJ-TYICEKJOSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
