Molecular Structure:
CCD No.:CCD02178002
SELENA SEL10433041
Formula:C12 H18 N2 O4 S
MolWeight:286.35
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10433041 |
| English Synonyms： | SELENA SEL10433041 |
| MDL Number.： | MFCD13494430 |
| H bond acceptor： | 6 |
| H bond donor： | 2 |
| Smile： | CCC(C)[C@@H](C(=O)O)NC(=O)Cn1c(csc1=O)C |
| InChi： | InChI=1S/C12H18N2O4S/c1-4-7(2)10(11(16)17)13-9(15)5-14-8(3)6-19-12(14)18/h6-7,10H,4-5H2,1-3H3,(H,13,15)(H,16,17)/t7?,10-/m0/s1 |
| InChiKey： | InChIKey=RPTWVHZHEGZNTD-MHPPCMCBSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
