Molecular Structure:
CCD No.:CCD02178007
SELENA SEL10433054
Formula:C13 H21 N3 O3
MolWeight:267.327
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10433054 |
| English Synonyms： | SELENA SEL10433054 |
| MDL Number.： | MFCD13494435 |
| H bond acceptor： | 6 |
| H bond donor： | 3 |
| Smile： | CCC(C)[C@@H](C(=O)O)NC(=O)Cc1c([nH]nc1C)C |
| InChi： | InChI=1S/C13H21N3O3/c1-5-7(2)12(13(18)19)14-11(17)6-10-8(3)15-16-9(10)4/h7,12H,5-6H2,1-4H3,(H,14,17)(H,15,16)(H,18,19)/t7?,12-/m0/s1 |
| InChiKey： | InChIKey=XCMTUKUBRGSVOJ-LRUBCLLZSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
