Molecular Structure:
CCD No.:CCD02178672
SELENA SEL10461738
Formula:C13 H21 N3 O3
MolWeight:267.327
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10461738 |
| English Synonyms： | SELENA SEL10461738 |
| MDL Number.： | MFCD13495100 |
| H bond acceptor： | 6 |
| H bond donor： | 2 |
| Smile： | Cc1c(c(n(n1)C)C)/C=C/C(=O)N(CCO)CCO |
| InChi： | InChI=1S/C13H21N3O3/c1-10-12(11(2)15(3)14-10)4-5-13(19)16(6-8-17)7-9-18/h4-5,17-18H,6-9H2,1-3H3/b5-4+ |
| InChiKey： | InChIKey=OZPMSXIDSYLSMQ-SNAWJCMRSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
