* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PAMAPIMOD |
CAS: | 449811-01-2 |
English Synonyms: | PAMAPIMOD |
MDL Number.: | MFCD14105621 |
H bond acceptor: | 8 |
H bond donor: | 3 |
Smile: | CC(C(CCO)Nc1ncc2cc(c(=O)n(c2n1)C)Oc3ccc(cc3F)F)O |
InChi: | InChI=1S/C19H20F2N4O4/c1-10(27)14(5-6-26)23-19-22-9-11-7-16(18(28)25(2)17(11)24-19)29-15-4-3-12(20)8-13(15)21/h3-4,7-10,14,26-27H,5-6H2,1-2H3,(H,22,23,24) |
InChiKey: | InChIKey=RGINMGDUOJVOTG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.