* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PHLOGACANTHOSIDE A |
| CAS: | 830347-18-7 |
| English Synonyms: | PHLOGACANTHOSIDE A |
| MDL Number.: | MFCD14155937 |
| H bond acceptor: | 9 |
| H bond donor: | 5 |
| Smile: | CC1=C2[C@@H](CC3=C([C@@H]2O)CC[C@H]4[C@]3(CCC[C@@]4(C)CO[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C)OC1=O |
| InChi: | InChI=1S/C26H38O9/c1-12-18-15(34-23(12)32)9-14-13(19(18)28)5-6-17-25(2,7-4-8-26(14,17)3)11-33-24-22(31)21(30)20(29)16(10-27)35-24/h15-17,19-22,24,27-31H,4-11H2,1-3H3/t15-,16-,17-,19+,20-,21+,22-,24-,25+,26+/m1/s1 |
| InChiKey: | InChIKey=USHSVQJEZJGRFF-CPHRPWCNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.