* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX115014 |
English Synonyms: | WUXIAPPTEC WX115014 |
MDL Number.: | MFCD14581099 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC(C)(C)OC(=O)N1C[C@H]2Cc3c(c(n[nH]3)I)[C@H]2C1 |
InChi: | InChI=1S/C13H18IN3O2/c1-13(2,3)19-12(18)17-5-7-4-9-10(8(7)6-17)11(14)16-15-9/h7-8H,4-6H2,1-3H3,(H,15,16)/t7-,8+/m1/s1 |
InChiKey: | InChIKey=IZDBZOQAAGYPPB-SFYZADRCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.