* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX140016 |
English Synonyms: | WUXIAPPTEC WX140016 |
MDL Number.: | MFCD14581116 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | CC(C)(C)OC(=O)N1CCc2c(nc[nH]2)C1C(=O)O |
InChi: | InChI=1S/C12H17N3O4/c1-12(2,3)19-11(18)15-5-4-7-8(14-6-13-7)9(15)10(16)17/h6,9H,4-5H2,1-3H3,(H,13,14)(H,16,17) |
InChiKey: | InChIKey=QSIMQYFAMRGECB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.