* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX115028-001 |
English Synonyms: | WUXIAPPTEC WX115028-001 ; WUXIAPPTEC WX115028-005 ; WUXIAPPTEC WX115028-010 |
MDL Number.: | MFCD14581365 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | [H][C@]12CCN(CC[C@]1([H])N1C=C(Br)N=C1CO2)C(=O)OC(C)(C)C |
InChi: | InChI=1S/C15H22BrN3O3/c1-15(2,3)22-14(20)18-6-4-10-11(5-7-18)21-9-13-17-12(16)8-19(10)13/h8,10-11H,4-7,9H2,1-3H3/t10-,11-/m0/s1 |
InChiKey: | InChIKey=USMMCASYHHWDEB-QWRGUYRKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.