* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX115032-001 |
English Synonyms: | WUXIAPPTEC WX115032-005 ; WUXIAPPTEC WX115032-001 ; WUXIAPPTEC WX115032-010 |
MDL Number.: | MFCD14581369 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | CC(C)(C)OC(=O)N1CC[C@@H]2OCC3=C(N=CN3[C@@H]2CC1)C(O)=O |
InChi: | InChI=1S/C16H23N3O5/c1-16(2,3)24-15(22)18-6-4-10-12(5-7-18)23-8-11-13(14(20)21)17-9-19(10)11/h9-10,12H,4-8H2,1-3H3,(H,20,21)/t10-,12+/m1/s1 |
InChiKey: | InChIKey=RZDULKXSSPQGNI-PWSUYJOCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.