* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX115060 |
English Synonyms: | WUXIAPPTEC WX115060 |
MDL Number.: | MFCD14581397 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CC(C)(C)OC(=O)N1CC[C@H]2[C@H](CC1)Oc3ccccc3S(=O)(=O)N2 |
InChi: | InChI=1S/C17H24N2O5S/c1-17(2,3)24-16(20)19-10-8-12-13(9-11-19)23-14-6-4-5-7-15(14)25(21,22)18-12/h4-7,12-13,18H,8-11H2,1-3H3/t12-,13-/m0/s1 |
InChiKey: | InChIKey=CRQDRWLAFBMKRI-STQMWFEESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.