* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-CYANO-3,5-DIMETHYLBENZOIC ACID |
| CAS: | 90924-01-9 |
| English Synonyms: | 4-CYANO-3,5-DIMETHYLBENZOIC ACID |
| MDL Number.: | MFCD14582959 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1cc(cc(c1C#N)C)C(=O)O |
| InChi: | InChI=1S/C10H9NO2/c1-6-3-8(10(12)13)4-7(2)9(6)5-11/h3-4H,1-2H3,(H,12,13) |
| InChiKey: | InChIKey=DNOXFFNRMSJGBK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.