* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | (1H-IMIDAZOL-4-YL)-PYRIDIN-3-YL-METHANOL |
| CAS: | 304457-84-9 |
| English Synonyms: | (1H-IMIDAZOL-4-YL)-PYRIDIN-3-YL-METHANOL |
| MDL Number.: | MFCD14583917 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1cc(cnc1)C(c2c[nH]cn2)O |
| InChi: | InChI=1S/C9H9N3O/c13-9(8-5-11-6-12-8)7-2-1-3-10-4-7/h1-6,9,13H,(H,11,12) |
| InChiKey: | InChIKey=RPYBRPKXQNEMHJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.