* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(1-METHYL-1H-IMIDAZOL-2-YL)-PHENYLAMINE 2HCL |
| English Synonyms: | 4-(1-METHYL-1H-IMIDAZOL-2-YL)-PHENYLAMINE 2HCL |
| MDL Number.: | MFCD14584101 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cn1ccnc1c2ccc(cc2)N.Cl.Cl |
| InChi: | InChI=1S/C10H11N3.2ClH/c1-13-7-6-12-10(13)8-2-4-9(11)5-3-8;;/h2-7H,11H2,1H3;2*1H |
| InChiKey: | InChIKey=YPDUUVYIYOCACB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.