* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9,9-DIHEXYL-9H-FLUORENE |
CAS: | 123863-97-8 |
English Synonyms: | 9,9-DIHEXYL-9H-FLUORENE ; 9,9-DIHEXYLFLUORENE |
MDL Number.: | MFCD14584648 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CCCCCCC1(c2ccccc2-c3c1cccc3)CCCCCC |
InChi: | InChI=1S/C25H34/c1-3-5-7-13-19-25(20-14-8-6-4-2)23-17-11-9-15-21(23)22-16-10-12-18-24(22)25/h9-12,15-18H,3-8,13-14,19-20H2,1-2H3 |
InChiKey: | InChIKey=LQQKFGSPUYTIRB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.