* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PROPYL(([2-(THIOPHEN-2-YL)-1,3-THIAZOL-4-YL]METHYL))AMINE |
| English Synonyms: | PROPYL(([2-(THIOPHEN-2-YL)-1,3-THIAZOL-4-YL]METHYL))AMINE |
| MDL Number.: | MFCD14587047 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCCNCc1csc(n1)c2cccs2 |
| InChi: | InChI=1S/C11H14N2S2/c1-2-5-12-7-9-8-15-11(13-9)10-4-3-6-14-10/h3-4,6,8,12H,2,5,7H2,1H3 |
| InChiKey: | InChIKey=QNHFJJWANGJYKY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.