* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PROPYL(([2-(THIOPHEN-3-YL)-1,3-THIAZOL-4-YL]METHYL))AMINE |
| English Synonyms: | PROPYL(([2-(THIOPHEN-3-YL)-1,3-THIAZOL-4-YL]METHYL))AMINE |
| MDL Number.: | MFCD14587048 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCCNCc1csc(n1)c2ccsc2 |
| InChi: | InChI=1S/C11H14N2S2/c1-2-4-12-6-10-8-15-11(13-10)9-3-5-14-7-9/h3,5,7-8,12H,2,4,6H2,1H3 |
| InChiKey: | InChIKey=MHSCBFFLBDLOTR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.