* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PROPYL(([2-(PYRIDIN-2-YL)-1,3-THIAZOL-5-YL]METHYL))AMINE |
| English Synonyms: | PROPYL(([2-(PYRIDIN-2-YL)-1,3-THIAZOL-5-YL]METHYL))AMINE |
| MDL Number.: | MFCD14615344 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCCNCc1cnc(s1)c2ccccn2 |
| InChi: | InChI=1S/C12H15N3S/c1-2-6-13-8-10-9-15-12(16-10)11-5-3-4-7-14-11/h3-5,7,9,13H,2,6,8H2,1H3 |
| InChiKey: | InChIKey=HUILBAXFSAZTDY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.