* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PROPYL(([2-(4H-1,2,4-TRIAZOL-3-YL)-1,3-THIAZOL-5-YL]METHYL))AMINE |
English Synonyms: | PROPYL(([2-(4H-1,2,4-TRIAZOL-3-YL)-1,3-THIAZOL-5-YL]METHYL))AMINE |
MDL Number.: | MFCD14615345 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CCCNCc1cnc(s1)c2[nH]cnn2 |
InChi: | InChI=1S/C9H13N5S/c1-2-3-10-4-7-5-11-9(15-7)8-12-6-13-14-8/h5-6,10H,2-4H2,1H3,(H,12,13,14) |
InChiKey: | InChIKey=BJJRSJGBOJPMCX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.