* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PROPYL(([2-(PYRIDIN-4-YL)-1,3-THIAZOL-5-YL]METHYL))AMINE |
| English Synonyms: | PROPYL(([2-(PYRIDIN-4-YL)-1,3-THIAZOL-5-YL]METHYL))AMINE |
| MDL Number.: | MFCD14615351 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCCNCc1cnc(s1)c2ccncc2 |
| InChi: | InChI=1S/C12H15N3S/c1-2-5-14-8-11-9-15-12(16-11)10-3-6-13-7-4-10/h3-4,6-7,9,14H,2,5,8H2,1H3 |
| InChiKey: | InChIKey=FJCVENZIBLIYPL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.