* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PAPUAMINE |
CAS: | 112455-84-2 |
English Synonyms: | PAPUAMINE |
MDL Number.: | MFCD14635392 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | C1CC[C@@H]2[C@@H](C1)C[C@@H]3[C@H]2/C=C/C=C/[C@H]4[C@@H]5CCCC[C@H]5C[C@H]4NCCCN3 |
InChi: | InChI=1S/C25H40N2/c1-3-10-20-18(8-1)16-24-22(20)12-5-6-13-23-21-11-4-2-9-19(21)17-25(23)27-15-7-14-26-24/h5-6,12-13,18-27H,1-4,7-11,14-17H2/b12-5+,13-6+/t18-,19-,20+,21+,22-,23-,24+,25+/m0/s1 |
InChiKey: | InChIKey=ZKTFUNZCYRUILZ-XVMYYXKMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.