* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PLATENSIMYCIN |
CAS: | 835876-32-9 |
English Synonyms: | PLATENSIMYCIN |
MDL Number.: | MFCD14635440 |
H bond acceptor: | 8 |
H bond donor: | 4 |
Smile: | C[C@]12C[C@]34CC1C[C@@H]([C@H]3[C@](C(=O)C=C4)(C)CCC(=O)Nc5c(ccc(c5O)C(=O)O)O)O2 |
InChi: | InChI=1S/C24H27NO7/c1-22(7-6-17(28)25-18-14(26)4-3-13(19(18)29)21(30)31)16(27)5-8-24-10-12-9-15(20(22)24)32-23(12,2)11-24/h3-5,8,12,15,20,26,29H,6-7,9-11H2,1-2H3,(H,25,28)(H,30,31)/t12?,15-,20-,22+,23-,24-/m0/s1 |
InChiKey: | InChIKey=CSOMAHTTWTVBFL-LGUINVFYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.