* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DIETHYL 4,4'''-DIMETHYL-2,2':6',2'':6'',2'''-QUATERPYRIDINE-4',4''-DICARBOXYLATE |
| CAS: | 913720-01-1 |
| English Synonyms: | DIETHYL 4,4'''-DIMETHYL-2,2':6',2'':6'',2'''-QUATERPYRIDINE-4',4''-DICARBOXYLATE |
| MDL Number.: | MFCD14636243 |
| H bond acceptor: | 8 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)c1cc(nc(c1)c2cc(cc(n2)c3cc(ccn3)C)C(=O)OCC)c4cc(ccn4)C |
| InChi: | InChI=1S/C28H26N4O4/c1-5-35-27(33)19-13-23(21-11-17(3)7-9-29-21)31-25(15-19)26-16-20(28(34)36-6-2)14-24(32-26)22-12-18(4)8-10-30-22/h7-16H,5-6H2,1-4H3 |
| InChiKey: | InChIKey=KIJWMKKXNURQFH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.