* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DIMETHYL 4'-[(9-ANTHRACENYL)-2,2':6',2''-TERPYRIDINE]-6,6''-DICARBOXYLATE |
| CAS: | 864678-43-3 |
| English Synonyms: | DIMETHYL 4'-[(9-ANTHRACENYL)-2,2':6',2''-TERPYRIDINE]-6,6''-DICARBOXYLATE |
| MDL Number.: | MFCD14636252 |
| H bond acceptor: | 7 |
| H bond donor: | 0 |
| Smile: | COC(=O)c1cccc(n1)c2cc(cc(n2)c3cccc(n3)C(=O)OC)c4c5ccccc5cc6c4cccc6 |
| InChi: | InChI=1S/C33H23N3O4/c1-39-32(37)27-15-7-13-25(34-27)29-18-22(19-30(36-29)26-14-8-16-28(35-26)33(38)40-2)31-23-11-5-3-9-20(23)17-21-10-4-6-12-24(21)31/h3-19H,1-2H3 |
| InChiKey: | InChIKey=KZKPKEDJKGINGA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.