* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PHARMABLOCK PBN20120527 |
| English Synonyms: | PHARMABLOCK PBN20120527 |
| MDL Number.: | MFCD14706048 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1c(nc(c(n1)N)Cl)I |
| InChi: | InChI=1S/C4H3ClIN3/c5-3-4(7)8-1-2(6)9-3/h1H,(H2,7,8) |
| InChiKey: | InChIKey=KVGKDDCJSHJYCS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.