* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(THIOPHEN-3-YL)-1,3-THIAZOL-2-AMINE |
| English Synonyms: | 4-THIEN-3-YL-1,3-THIAZOL-2-AMINE ; 4-(THIOPHEN-3-YL)-1,3-THIAZOL-2-AMINE ; 2-AMINO-4-(THIEN-3-YL)-1,3-THIAZOLE ; 2-AMINO-4-(3-THIENYL)THIAZOLE |
| MDL Number.: | MFCD14707003 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1cscc1c2csc(n2)N |
| InChi: | InChI=1S/C7H6N2S2/c8-7-9-6(4-11-7)5-1-2-10-3-5/h1-4H,(H2,8,9) |
| InChiKey: | InChIKey=SBOMEHIUYMFKNH-UHFFFAOYSA-N |
|
|
| Comments: | WARNINGS: IRRITANT |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.