* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PPQ-102 |
| CAS: | 931706-15-9 |
| English Synonyms: | PPQ-102 ; 7,9-DIMETHYL-6-(5-METHYL-FURAN-2-YL)-11-PHENYL-6,7-DIHYDRO-5H-5,7,9,11A-TETRAAZA-BENZO[A]FLUORENE-8,10-DIONE |
| MDL Number.: | MFCD14824240 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(o1)C2c3c4c(c(n3-c5ccccc5N2)c6ccccc6)c(=O)n(c(=O)n4C)C |
| InChi: | InChI=1S/C26H22N4O3/c1-15-13-14-19(33-15)21-24-23-20(25(31)29(3)26(32)28(23)2)22(16-9-5-4-6-10-16)30(24)18-12-8-7-11-17(18)27-21/h4-14,21,27H,1-3H3 |
| InChiKey: | InChIKey=MNOOVRNGPIWJDI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.