Molecular Structure:
CCD No.:CCD02380582
QS-4-D6
Formula:C13 H10 D6 O6
MolWeight:274.3
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | QS-4-D6 |
| English Synonyms： | QS-4-D6 |
| MDL Number.： | MFCD15071250 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | [2H]C([2H])([2H])OC1=C(C(=O)C(=C(C1=O)C)CCCC(=O)O)OC([2H])([2H])[2H] |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
