* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | D-PROLINE, 5-(4-FLUOROPHENYL)-, ETHYL ESTER, (5S)- |
| CAS: | 1050392-42-1 |
| English Synonyms: | D-PROLINE, 5-(4-FLUOROPHENYL)-, ETHYL ESTER, (5S)- |
| MDL Number.: | MFCD15071989 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCOC(=O)[C@H]1CC[C@H](N1)c2ccc(cc2)F |
| InChi: | InChI=1S/C13H16FNO2/c1-2-17-13(16)12-8-7-11(15-12)9-3-5-10(14)6-4-9/h3-6,11-12,15H,2,7-8H2,1H3/t11-,12+/m0/s1 |
| InChiKey: | InChIKey=LWOOFZWQLXTMLV-NWDGAFQWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.