* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-METHOXY-1H,3H-FURO[3,4-C]PYRIDIN-1-ONE |
| CAS: | 880767-57-7 |
| English Synonyms: | 4-METHOXY-1H,3H-FURO[3,4-C]PYRIDIN-1-ONE ; 4-METHOXY-FURO[3,4-C]PYRIDIN-1(3H)-ONE |
| MDL Number.: | MFCD15143994 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | COc1c2c(ccn1)C(=O)OC2 |
| InChi: | InChI=1S/C8H7NO3/c1-11-7-6-4-12-8(10)5(6)2-3-9-7/h2-3H,4H2,1H3 |
| InChiKey: | InChIKey=GKQIBRIEXOOANY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.