* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-ETHOXY-2(5H)-FURANONE |
| CAS: | 69556-72-5 |
| English Synonyms: | 4-ETHOXY-2,5-DIHYDROFURAN-2-ONE ; 4-ETHOXY-2(5H)-FURANONE |
| MDL Number.: | MFCD15145894 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CCOC1=CC(=O)OC1 |
| InChi: | InChI=1S/C6H8O3/c1-2-8-5-3-6(7)9-4-5/h3H,2,4H2,1H3 |
| InChiKey: | InChIKey=WRXKKVYMUWQSDZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.