* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FURO[2,3-D]PYRIMIDINE-2,4,5(1H,3H,6H)-TRIONE |
CAS: | 672286-69-0 |
English Synonyms: | FURO[2,3-D]PYRIMIDINE-2,4,5(1H,3H,6H)-TRIONE |
MDL Number.: | MFCD15146060 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | C1C(=O)c2c(=O)[nH]c(=O)[nH]c2O1 |
InChi: | InChI=1S/C6H4N2O4/c9-2-1-12-5-3(2)4(10)7-6(11)8-5/h1H2,(H2,7,8,10,11) |
InChiKey: | InChIKey=HVFMJCJZTLYTKI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.