* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-HYDROXY-1,2,3,4,4A,5,6,11A-OCTAHYDRO-8H-PYRIDO[1,2-A]QUINOXALIN-8-ONE |
English Synonyms: | 9-HYDROXY-1,2,3,4,4A,5,6,11A-OCTAHYDRO-8H-PYRIDO[1,2-A]QUINOXALIN-8-ONE ; CHEMDIV-BB BB52-7732 |
MDL Number.: | MFCD15203849 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1c2n(cc(c1=O)O)C3CCCCC3NC2 |
InChi: | InChI=1S/C12H16N2O2/c15-11-5-8-6-13-9-3-1-2-4-10(9)14(8)7-12(11)16/h5,7,9-10,13,16H,1-4,6H2 |
InChiKey: | InChIKey=OYXZENZTYWZNNE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.