* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PROPYL((4-[2-(THIOPHEN-2-YL)-1H-IMIDAZOL-1-YL]BUTAN-2-YL))AMINE |
| English Synonyms: | PROPYL((4-[2-(THIOPHEN-2-YL)-1H-IMIDAZOL-1-YL]BUTAN-2-YL))AMINE |
| MDL Number.: | MFCD15434680 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCCNC(C)CCn1ccnc1c2cccs2 |
| InChi: | InChI=1S/C14H21N3S/c1-3-7-15-12(2)6-9-17-10-8-16-14(17)13-5-4-11-18-13/h4-5,8,10-12,15H,3,6-7,9H2,1-2H3 |
| InChiKey: | InChIKey=YUTVOEHURULMKH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.